5-(2-thiophene)-2-thiobarbituric acid
Modify Date: 2025-09-25 20:38:23
5-(2-thiophene)-2-thiobarbituric acid structure
|
Common Name | 5-(2-thiophene)-2-thiobarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 120244-32-8 | Molecular Weight | 238.28600 | |
| Density | 1.57g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Molecular Formula | C9H6N2O2S2 |
| Molecular Weight | 238.28600 |
| Exact Mass | 237.98700 |
| PSA | 125.51000 |
| LogP | 1.21420 |
| Index of Refraction | 1.726 |
| InChIKey | WCJYQNYSKWLZTR-UHFFFAOYSA-N |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cccs1 |
|
~92%
5-(2-thiophene)... CAS#:120244-32-8 |
| Literature: Paasz, Aleksandra Synthesis, 2010 , # 23 art. no. T12110SS, p. 4021 - 4032 |
|
~56%
5-(2-thiophene)... CAS#:120244-32-8 |
| Literature: Abdel-Latif Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1991 , vol. 30, # 3 p. 363 - 365 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| F0285-0186 |
| 5-Ttba |