4-Chlor-2-cyano-5-(4-Methylphenyl)iMidazol
Modify Date: 2025-08-25 18:20:12
4-Chlor-2-cyano-5-(4-Methylphenyl)iMidazol structure
|
Common Name | 4-Chlor-2-cyano-5-(4-Methylphenyl)iMidazol | ||
|---|---|---|---|---|
| CAS Number | 120118-14-1 | Molecular Weight | 217.65400 | |
| Density | 1.362g/cm3 | Boiling Point | 410.891ºC at 760 mmHg | |
| Molecular Formula | C11H8ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | 5-Chloro-4-(4-methylphenyl)-1H-imidazole-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 410.891ºC at 760 mmHg |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.65400 |
| Flash Point | 202.3ºC |
| Exact Mass | 217.04100 |
| PSA | 52.47000 |
| LogP | 2.91018 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | AHLIZUWPYRQFHY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc(C#N)[nH]c2Cl)cc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-5-(4-tolyl)-imidazole-2-carbonitrile |
| 4-Chloro-5-(p-tolyl)-1H-imidazole-2-carbonitrile |
| 4-Chlor-2-cyano-5-(4-Methylphenyl)iMidazol |