2-methyl-1-nitro-4-prop-2-enoxybenzene structure
|
Common Name | 2-methyl-1-nitro-4-prop-2-enoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 120106-18-5 | Molecular Weight | 193.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-1-nitro-4-prop-2-enoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO3 |
|---|---|
| Molecular Weight | 193.19900 |
| Exact Mass | 193.07400 |
| PSA | 55.05000 |
| LogP | 2.99120 |
| InChIKey | DGLFFFUDCZTPCT-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc([N+](=O)[O-])c(C)c1 |
|
~95%
2-methyl-1-nitr... CAS#:120106-18-5 |
| Literature: Sainsbury, Malcolm; Smith, Andrew D.; Vong, Kuok K.; Scopes, David I. C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2945 - 2954 |
|
~10%
2-methyl-1-nitr... CAS#:120106-18-5 |
| Literature: Macor; Ryan; Newman Tetrahedron, 1992 , vol. 48, # 6 p. 1039 - 1052 |
| 1-allyloxy-3-methyl-4-nitrobenzene |