5-(Acetylamino)-2-chloro-2,5-dideoxy-3-S-phenyl-3-thio-D-erythro-α-L-gluco-2-nonulopyranosonic Acid Methyl Ester 4,7,8,9-Tetraacetate structure
|
Common Name | 5-(Acetylamino)-2-chloro-2,5-dideoxy-3-S-phenyl-3-thio-D-erythro-α-L-gluco-2-nonulopyranosonic Acid Methyl Ester 4,7,8,9-Tetraacetate | ||
|---|---|---|---|---|
| CAS Number | 120104-58-7 | Molecular Weight | 618.05000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32ClNO12S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(Acetylamino)-2-chloro-2,5-dideoxy-3-S-phenyl-3-thio-D-erythro-|A-L-gluco-2-nonulopyranosonic Acid Methyl Ester 4,7,8,9-Tetraacetate |
|---|
| Molecular Formula | C26H32ClNO12S |
|---|---|
| Molecular Weight | 618.05000 |
| Exact Mass | 617.13300 |
| PSA | 195.13000 |
| LogP | 1.90800 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | UCRSUTGMKNMKAW-CSKOYBJVSA-N |
| SMILES | COC(=O)C1(Cl)OC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)C(NC(C)=O)C(OC(C)=O)C1Sc1ccccc1 |
|
~%
5-(Acetylamino)... CAS#:120104-58-7 |
| Literature: Ercegovic, Teddy; Magnusson, Goeran Journal of the Chemical Society, Chemical Communications, 1994 , # 7 p. 831 - 832 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |