Goralatide
Modify Date: 2025-08-21 18:54:47
Goralatide structure
|
Common Name | Goralatide | ||
|---|---|---|---|---|
| CAS Number | 120081-14-3 | Molecular Weight | 487.50400 | |
| Density | 1.382g/cm3 | Boiling Point | 992ºC at 760mmHg | |
| Molecular Formula | C20H33N5O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 553.7ºC | |
Use of GoralatideGoralatide is isolated from fetal calf bone marrow; exerts a high inhibitory activity on the proliferation of hematopoietic pluripotent stem cells. |
| Name | (2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-6-aminohexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 992ºC at 760mmHg |
| Molecular Formula | C20H33N5O9 |
| Molecular Weight | 487.50400 |
| Flash Point | 553.7ºC |
| Exact Mass | 487.22800 |
| PSA | 228.46000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | HJDRXEQUFWLOGJ-AJNGGQMLSA-N |
| SMILES | CC(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |
| N-acetyl-Ser-Asp-Lys-Pro |
| acetyl-N-Ser-Asp-Lys-Pro |
| Goralatide |
| N-acetyl-seryl-aspartyl-lysyl-proline |
| Ac-Ser-Asp-Lys-Pro |
| acetyl-seryl-aspartyl-lysyl-proline |
| acetyl-SDKP |
| seraspenide |
| AcSDKP |
| NAcSerAspLysPro |
| Ac-Ser-Asp-Lys-Pro-OH |