9,10-dihydroxystearic acid structure
|
Common Name | 9,10-dihydroxystearic acid | ||
|---|---|---|---|---|
| CAS Number | 120-87-6 | Molecular Weight | 316.476 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 481.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C18H36O4 | Melting Point | 92-94ºC | |
| MSDS | N/A | Flash Point | 259.2±19.7 °C | |
Use of 9,10-dihydroxystearic acid9,10-Dihydroxystearic acid is an oxidation product of oleic acid. 9,10-Dihydroxystearic acid can improve glucose tolerance and insulin sensitivity in KKAy mice[1]. |
| Name | 9,10-dihydroxystearic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 9,10-Dihydroxystearic acid is an oxidation product of oleic acid. 9,10-Dihydroxystearic acid can improve glucose tolerance and insulin sensitivity in KKAy mice[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 5-20 μmol/L 9,10-Dihydroxystearic acid (DHSA) does not activate PPAR-γ in CV-1 cells but 50-100 μmol/L DHSA activates PPAR-γ in a dose-dependent way. 9,10-Dihydroxystearic acid does not activate PPAR-α in CV-1 cells[1]. |
| In Vivo | 9,10-Dihydroxystearic acid (DHSA; fed with high fat diet containing 4% DHSA; for 5-6 weeks) treatment improves glucose tolerance and insulin sensitivity in KKAy mice[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.6±25.0 °C at 760 mmHg |
| Melting Point | 92-94ºC |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.476 |
| Flash Point | 259.2±19.7 °C |
| Exact Mass | 316.261353 |
| PSA | 77.76000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | VACHUYIREGFMSP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918199090 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9 10-DIHYDROXYOCTADECANOIC ACID |
| Octadecanoic acid, 9,10-dihydroxy- |
| 9,10-DIHYDROXYSTEARIC ACID |
| 9,10-Dihydroxyoctadecanoic acid |
| 9,10-Dihydroxystearate |
| EINECS 204-432-2 |