4-[(E)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]benzoic acid structure
|
Common Name | 4-[(E)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 119999-05-2 | Molecular Weight | 348.47800 | |
| Density | 1.06g/cm3 | Boiling Point | 486.8ºC at 760 mmHg | |
| Molecular Formula | C24H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | 4-[(E)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]benzoic acid |
|---|
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 486.8ºC at 760 mmHg |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.47800 |
| Flash Point | 228.6ºC |
| Exact Mass | 348.20900 |
| PSA | 37.30000 |
| LogP | 6.29430 |
| Vapour Pressure | 2.72E-10mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | NUSIBKZXKHKYDB-JQIJEIRASA-N |
| SMILES | CC(=Cc1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(C(=O)O)cc1 |
|
~96%
4-[(E)-1-(5,5,8... CAS#:119999-05-2 |
| Literature: Dawson; Hobbs; Derdzinski; Chao; Frenking; Loew; Jetten; Napoli; Williams; Sani; Wille Jr.; Schiff Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1504 - 1517 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |