1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylic acid
Modify Date: 2025-08-26 12:10:49
1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylic acid structure
|
Common Name | 1-(4-bromophenyl)-3-hydroxycyclobutanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1199556-64-3 | Molecular Weight | 271.107 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 426.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.5±28.7 °C | |
| Name | 1-(4-bromophenyl)-3-hydroxycyclobutane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.2±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.107 |
| Flash Point | 211.5±28.7 °C |
| Exact Mass | 269.989136 |
| PSA | 57.53000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | DIFJFJOUEOLYGY-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Br)cc2)CC(O)C1 |
| HS Code | 2918199090 |
|---|
|
~%
1-(4-bromopheny... CAS#:1199556-64-3 |
| Literature: MERCK and CO., INC.; BANYU PHARMACEUTICAL CO., LTD. Patent: WO2009/148887 A1, 2009 ; Location in patent: Page/Page column 61 ; WO 2009/148887 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(4-Bromophenyl)-3-hydroxycyclobutanecarboxylic acid |
| Cyclobutanecarboxylic acid, 1-(4-bromophenyl)-3-hydroxy- |