Ethyl 4-(3-bromo-4-formylphenoxy)benzoate
Modify Date: 2025-08-26 17:26:42
Ethyl 4-(3-bromo-4-formylphenoxy)benzoate structure
|
Common Name | Ethyl 4-(3-bromo-4-formylphenoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1196474-68-6 | Molecular Weight | 349.17600 | |
| Density | N/A | Boiling Point | 440.1±45.0°C at 760 mmHg | |
| Molecular Formula | C16H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 4-(3-bromo-4-formylphenoxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 440.1±45.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C16H13BrO4 |
| Molecular Weight | 349.17600 |
| Exact Mass | 348.00000 |
| PSA | 52.60000 |
| LogP | 4.23060 |
| InChIKey | ZETWHASWJSGZSB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Oc2ccc(C=O)c(Br)c2)cc1 |
| HS Code | 2918990090 |
|---|
|
~97%
Ethyl 4-(3-brom... CAS#:1196474-68-6 |
| Literature: Anacor Pharmaceuticals, Inc.; GlaxoSmithKline Patent: US2010/256092 A1, 2010 ; Location in patent: Page/Page column 76-77 ; US 20100256092 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD18206333 |