PF3845yne
Modify Date: 2025-08-20 18:48:06
PF3845yne structure
|
Common Name | PF3845yne | ||
|---|---|---|---|---|
| CAS Number | 1196109-53-1 | Molecular Weight | 412.48400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H24N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF3845ynePF3845yne is a Alkyne analogues of PF3845. |
| Name | 4-[[3-(5-ethynylpyridin-2-yl)oxyphenyl]methyl]-N-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H24N4O2 |
|---|---|
| Molecular Weight | 412.48400 |
| Exact Mass | 412.19000 |
| PSA | 70.84000 |
| LogP | 4.68830 |
| InChIKey | YOUNTNMKNQNFDV-UHFFFAOYSA-N |
| SMILES | C#Cc1ccc(Oc2cccc(CC3CCN(C(=O)Nc4cccnc4)CC3)c2)nc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PF3845yne |
| cc-146 |
| Y0340 |