(3R,4S)-3-[1-[hydroxy(methyl)amino]ethyl]-4-(3-methoxyphenyl)-1,1-dioxothian-4-ol
Modify Date: 2025-09-22 12:54:28
![(3R,4S)-3-[1-[hydroxy(methyl)amino]ethyl]-4-(3-methoxyphenyl)-1,1-dioxothian-4-ol Structure](https://image.chemsrc.com/caspic/475/119558-28-0.png)
(3R,4S)-3-[1-[hydroxy(methyl)amino]ethyl]-4-(3-methoxyphenyl)-1,1-dioxothian-4-ol structure
|
Common Name | (3R,4S)-3-[1-[hydroxy(methyl)amino]ethyl]-4-(3-methoxyphenyl)-1,1-dioxothian-4-ol | ||
|---|---|---|---|---|
| CAS Number | 119558-28-0 | Molecular Weight | 329.41200 | |
| Density | 1.299g/cm3 | Boiling Point | 578.9ºC at 760 mmHg | |
| Molecular Formula | C15H23NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.9ºC | |
| Name | (3R,4S)-3-[1-[hydroxy(methyl)amino]ethyl]-4-(3-methoxyphenyl)-1,1-dioxothian-4-ol |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 578.9ºC at 760 mmHg |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.41200 |
| Flash Point | 303.9ºC |
| Exact Mass | 329.13000 |
| PSA | 95.45000 |
| LogP | 2.10780 |
| Vapour Pressure | 3.05E-14mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | FARFFAFXGJTXOU-PJYWTSEFSA-N |
| SMILES | COc1cccc(C2(O)CCS(=O)(=O)CC2C(C)N(C)O)c1 |
|
~54%
(3R,4S)-3-[1-[h... CAS#:119558-28-0 |
| Literature: Urban, Jiri; Svatek, Emil; Ryska, Miroslav; Metys, Jan; Wildt, Stanislav; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 5 p. 1340 - 1351 |
|
~%
(3R,4S)-3-[1-[h... CAS#:119558-28-0 |
| Literature: Urban, Jiri; Svatek, Emil; Ryska, Miroslav; Metys, Jan; Wildt, Stanislav; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 5 p. 1340 - 1351 |
|
~%
(3R,4S)-3-[1-[h... CAS#:119558-28-0 |
| Literature: Urban, Jiri; Svatek, Emil; Ryska, Miroslav; Metys, Jan; Wildt, Stanislav; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 5 p. 1340 - 1351 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |