Boc-DL-2-pyridylalanine structure
|
Common Name | Boc-DL-2-pyridylalanine | ||
|---|---|---|---|---|
| CAS Number | 119434-71-8 | Molecular Weight | 266.293 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 436.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.0±27.3 °C | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridin-2-ylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.9±40.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.293 |
| Flash Point | 218.0±27.3 °C |
| Exact Mass | 266.126648 |
| PSA | 92.01000 |
| LogP | 1.47 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | KMODKKCXWFNEIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccn1)C(=O)O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-(2-pyridinyl)alanine |
| Boc-3-(2-Pyridyl)-DL-alanine |
| 3-Pyridin-2-yl-L-alanine,N-BOC protected |
| 2-Pyridinepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 2-Tert-Butoxycarbonylamino-3-Pyridin-2-Yl-Propionic Acid |