Ethyl-6(S),7-isopropylidenedioxy-hept-4-enoate structure
|
Common Name | Ethyl-6(S),7-isopropylidenedioxy-hept-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 119392-30-2 | Molecular Weight | 228.28500 | |
| Density | 1.063g/cm3 | Boiling Point | 279.2ºC at 760mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.2ºC | |
| Name | ethyl-6(s),7-isopropylidenedioxy-hept-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 279.2ºC at 760mmHg |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 116.2ºC |
| Exact Mass | 228.13600 |
| PSA | 44.76000 |
| LogP | 2.03740 |
| Vapour Pressure | 0.00407mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | RRSJYUBUPNAAFL-STUBTGCMSA-N |
| SMILES | CCOC(=O)CCC=CC1COC(C)(C)O1 |
|
~84%
Ethyl-6(S),7-is... CAS#:119392-30-2 |
| Literature: Merrer, Yves Le; Gravier-Pelletier, Christine; Micas-Languin, Dominique; Mestre, Francoise; Dureault, Annie; Depezay, Jean-Claude Journal of Organic Chemistry, 1989 , vol. 54, # 10 p. 2409 - 2416 |
|
~%
Ethyl-6(S),7-is... CAS#:119392-30-2 |
| Literature: Merrer, Yves Le; Gravier-Pelletier, Christine; Micas-Languin, Dominique; Mestre, Francoise; Dureault, Annie; Depezay, Jean-Claude Journal of Organic Chemistry, 1989 , vol. 54, # 10 p. 2409 - 2416 |
| ethyl 6-morpholinopyridine-2-carboxylate |