Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis-
Modify Date: 2025-09-14 12:28:21
Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- structure
|
Common Name | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- | ||
|---|---|---|---|---|
| CAS Number | 119301-59-6 | Molecular Weight | 396.43500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H20O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | tetra(p-hydroxyphenyl)ethylene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H20O4 |
|---|---|
| Molecular Weight | 396.43500 |
| Exact Mass | 396.13600 |
| PSA | 80.92000 |
| LogP | 5.51640 |
| InChIKey | QQUZHNPGWNIYMK-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C(=C(c2ccc(O)cc2)c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Facile synthesis of soluble nonlinear polymers with glycogen-like structures and functional properties from “simple” acrylic monomers Rongrong Hu; Jacky W. Y. Lam; Yong Yu; Herman H. Y. Sung; Ian D. Williams; et al
Polym. Chem. 4 , 95, (2013)
|
| tetrakis(4-hydroxyphenyl)ethylene |
| 1,1,2,2-tetrakis-(4-hydroxyphenyl)ethylene |
| 1,1,2,2-tetrakis(4-hydroxyphenyl)ethylene |
| tetrakis(4-hydroxytetraphenyl)ethene |
| 4,4',4'',4'''-(ethene-1,1,2,2-tetrayl)tetraphenol |
| tetrahydroxy tetraphenylethylene |