3-bromo-5-(trifluoromethoxy)benzene-1,2-diamine
Modify Date: 2024-09-17 17:06:52
3-bromo-5-(trifluoromethoxy)benzene-1,2-diamine structure
|
Common Name | 3-bromo-5-(trifluoromethoxy)benzene-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 1191922-50-5 | Molecular Weight | 271.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6BrF3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-5-(trifluoromethoxy)benzene-1,2-diamine |
|---|
| Molecular Formula | C7H6BrF3N2O |
|---|---|
| Molecular Weight | 271.03500 |
| Exact Mass | 269.96200 |
| PSA | 61.27000 |
| LogP | 3.67450 |
| InChIKey | NWUBWBRCEFGWHI-UHFFFAOYSA-N |
| SMILES | Nc1cc(OC(F)(F)F)cc(Br)c1N |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |