(2Z)-2,3-Dehydroxy Atorvastatin (>90% Z) structure
|
Common Name | (2Z)-2,3-Dehydroxy Atorvastatin (>90% Z) | ||
|---|---|---|---|---|
| CAS Number | 1191901-60-6 | Molecular Weight | 540.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H33FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2Z)-2,3-Dehydroxy Atorvastatin (>90% Z) |
|---|
| Molecular Formula | C33H33FN2O4 |
|---|---|
| Molecular Weight | 540.62 |
| Appearance of Characters | Solid | Pale Yellow to Light Yellow |
| InChIKey | MBPXXTUUUBBIRF-SPEKIDPZSA-N |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC=CC(=O)O |
| Storage condition | -20°C Freezer |
| Water Solubility | Chloroform, Dichloromethane, Methanol (Slightly, Heated) |