17-(N,N,-diisopropylcarbamoyl)androst-3,5-diene-3-carboxylic acid
Modify Date: 2025-08-25 10:34:33
17-(N,N,-diisopropylcarbamoyl)androst-3,5-diene-3-carboxylic acid structure
|
Common Name | 17-(N,N,-diisopropylcarbamoyl)androst-3,5-diene-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 119190-36-2 | Molecular Weight | 427.61900 | |
| Density | 1.11g/cm3 | Boiling Point | 580.6ºC at 760mmHg | |
| Molecular Formula | C27H41NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.9ºC | |
| Name | (8S,9S,10R,13S,14S,17S)-17-[di(propan-2-yl)carbamoyl]-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 580.6ºC at 760mmHg |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.61900 |
| Flash Point | 304.9ºC |
| Exact Mass | 427.30900 |
| PSA | 57.61000 |
| LogP | 5.83170 |
| Vapour Pressure | 5.47E-15mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | JDAULUKGZUDSNK-JRZBRKEGSA-N |
| SMILES | CC(C)N(C(=O)C1CCC2C3CC=C4C=C(C(=O)O)CCC4(C)C3CCC12C)C(C)C |
|
~%
17-(N,N,-diisop... CAS#:119190-36-2 |
| Literature: Holt, Dennis A.; Levy, Mark A.; Oh, Hye-Ja; Erb, Jill M.; Heaslip, Julie I.; et al. Journal of Medicinal Chemistry, 1990 , vol. 33, # 3 p. 943 - 950 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| dcadc |