2-Chloro-4-nitrophenyl α-D-glucopyranoside
Modify Date: 2025-08-25 16:31:19
2-Chloro-4-nitrophenyl α-D-glucopyranoside structure
|
Common Name | 2-Chloro-4-nitrophenyl α-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 119047-14-2 | Molecular Weight | 335.694 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 591.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H14ClNO8 | Melting Point | 127-130ºC | |
| MSDS | N/A | Flash Point | 311.3±30.1 °C | |
| Name | (2R,3R,4S,5S,6R)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.2±50.0 °C at 760 mmHg |
| Melting Point | 127-130ºC |
| Molecular Formula | C12H14ClNO8 |
| Molecular Weight | 335.694 |
| Flash Point | 311.3±30.1 °C |
| Exact Mass | 335.040802 |
| PSA | 145.20000 |
| LogP | 0.10 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | PJCVBKZRKNFZOD-ZIQFBCGOSA-N |
| SMILES | O=[N+]([O-])c1ccc(OC2OC(CO)C(O)C(O)C2O)c(Cl)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| α-D-Glucopyranoside, 2-chloro-4-nitrophenyl |
| 2-Chloro-4-nitrophenyl α-D-glucopyranoside |
| W0130 |
| 2-Chloro-4-nitrophenyl-Alpha-D-glucopyranoside |
| 2-Chloro-4-nitrophenyl-a-D-glucopyranoside |