methyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate structure
|
Common Name | methyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1190310-82-7 | Molecular Weight | 255.068 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 388.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.5±26.5 °C | |
| Name | Methyl 3-bromo-7-azaindole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.1±37.0 °C at 760 mmHg |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.068 |
| Flash Point | 188.5±26.5 °C |
| Exact Mass | 253.969086 |
| PSA | 54.98000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | UFCOEIYKKJULJF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccnc2[nH]cc(Br)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate |