glimepiride related compound c (20 mg) (glimepiride urethane)
Modify Date: 2025-08-25 06:03:25
glimepiride related compound c (20 mg) (glimepiride urethane) structure
|
Common Name | glimepiride related compound c (20 mg) (glimepiride urethane) | ||
|---|---|---|---|---|
| CAS Number | 119018-30-3 | Molecular Weight | 409.457 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H23N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-[4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]phenyl]sulfonylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.457 |
| Exact Mass | 409.130768 |
| PSA | 137.24000 |
| LogP | 0.97 |
| Index of Refraction | 1.569 |
| InChIKey | UZDRZEOOIXNUTE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)OC)cc2)C1=O |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Glimepiride urethane |
| Carbamic acid, N-[[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]-, methyl ester |
| Methyl {[4-(2-{[(3-ethyl-4-methyl-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)carbonyl]amino}ethyl)phenyl]sulfonyl}carbamate |