Chlorothiazide-13C,15N2 structure
|
Common Name | Chlorothiazide-13C,15N2 | ||
|---|---|---|---|---|
| CAS Number | 1189440-79-6 | Molecular Weight | 298.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6ClN3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Chlorothiazide-13C,15N2Chlorothiazide-13C,15N2 is the 13C and 15N labeled Chlorothiazide[1]. Chlorothiazide is an orally active diuretic and anti-hypertensive agent[2]. |
| Name | 6-chloro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Chlorothiazide-13C,15N2 is the 13C and 15N labeled Chlorothiazide[1]. Chlorothiazide is an orally active diuretic and anti-hypertensive agent[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C7H6ClN3O4S2 |
|---|---|
| Molecular Weight | 298.70300 |
| Exact Mass | 297.94600 |
| PSA | 135.45000 |
| LogP | 2.56540 |
| InChIKey | JBMKAUGHUNFTOL-FWIHXHLNSA-N |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC=NS2(=O)=O |
| 6-Chloro-2H-1,2,4-benzothiadiazine-7-sulfonamide-13C,15N2 1,1-dioxide |
| Chlorothiazide-13C,15N2 |
| Diuril-13C,15N2 |
| 6-Chloro-7-sulfamyl-1,2,4-benzothiadiazine-1,1-dioxide-13C,15N2 |
| Chlotride-13C,15N2 |
| Chlorthiazide-13C,15N2 |
| Saluric-13C,15N2 |