1-ethenyl-4-methylbenzene,2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate
Modify Date: 2025-09-21 11:18:45
1-ethenyl-4-methylbenzene,2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate structure
|
Common Name | 1-ethenyl-4-methylbenzene,2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 118922-88-6 | Molecular Weight | 444.64700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethenyl-4-methylbenzene,2-ethylhexyl prop-2-enoate,2-methylpropyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H44O4 |
|---|---|
| Molecular Weight | 444.64700 |
| Exact Mass | 444.32400 |
| PSA | 52.60000 |
| LogP | 7.33170 |
| InChIKey | OBAUZKJVLYTAOD-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)OCC(CC)CCCC.C=Cc1ccc(C)cc1 |
| 2-Propenoic acid,2-methyl-,2-methylpropyl ester,polymer with 1-ethenyl-4-methylbenzene and 2-ethylhexyl 2-propenoate |