2-methylsulfonyl-9-phenylpurine structure
|
Common Name | 2-methylsulfonyl-9-phenylpurine | ||
|---|---|---|---|---|
| CAS Number | 118807-52-6 | Molecular Weight | 274.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylsulfonyl-9-phenylpurine |
|---|
| Molecular Formula | C12H10N4O2S |
|---|---|
| Molecular Weight | 274.29800 |
| Exact Mass | 274.05200 |
| PSA | 86.12000 |
| LogP | 2.29980 |
| InChIKey | QPLKWTSLUNTELE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ncc2ncn(-c3ccccc3)c2n1 |
|
~76%
2-methylsulfony... CAS#:118807-52-6 |
| Literature: Tanji; Kubota; Yamamoto; Higashino Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4972-4976 |
|
~%
2-methylsulfony... CAS#:118807-52-6 |
| Literature: Tanji; Kubota; Yamamoto; Higashino Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4972-4976 |
|
~%
2-methylsulfony... CAS#:118807-52-6 |
| Literature: Tanji; Kubota; Yamamoto; Higashino Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4972-4976 |
|
~%
2-methylsulfony... CAS#:118807-52-6 |
| Literature: Tanji; Kubota; Yamamoto; Higashino Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4972-4976 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |