1-chloro-4-[2-(4-chlorophenyl)ethenylsulfonylmethyl]benzene structure
|
Common Name | 1-chloro-4-[2-(4-chlorophenyl)ethenylsulfonylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 118672-29-0 | Molecular Weight | 327.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-[2-(4-chlorophenyl)ethenylsulfonylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12Cl2O2S |
|---|---|
| Molecular Weight | 327.22600 |
| Exact Mass | 325.99400 |
| PSA | 42.52000 |
| LogP | 5.65990 |
| InChIKey | WXVZZCHUAIGQKJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(C=Cc1ccc(Cl)cc1)Cc1ccc(Cl)cc1 |
|
~81%
1-chloro-4-[2-(... CAS#:118672-29-0 |
| Literature: Temple University-of the Commonwealth System of Higher Education Patent: US6548553 B2, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| E-4-chlorostyryl 4-chlorobenzyl sulfone |