APP-CHMINACA
Modify Date: 2025-08-21 16:16:46
APP-CHMINACA structure
|
Common Name | APP-CHMINACA | ||
|---|---|---|---|---|
| CAS Number | 1185887-14-2 | Molecular Weight | 404.505 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 707.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C24H28N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 381.4±32.9 °C | |
Use of APP-CHMINACAAPP-CHMINACA is a synthetic cannabinoid (CB) featuring a 1-(cyclohexylmethyl)-1H-indazole-3-carboxamide (CHMINACA) base. It displays a 10-fold greater affinity for the central CB1 receptor than that of JWH 018. |
| Name | APP-CHMINACA |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 707.0±60.0 °C at 760 mmHg |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.505 |
| Flash Point | 381.4±32.9 °C |
| Exact Mass | 404.221222 |
| LogP | 4.29 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | DMHWDSGURMXMGE-FQEVSTJZSA-N |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)c1nn(CC2CCCCC2)c2ccccc12 |
| Nα-{[1-(Cyclohexylmethyl)-1H-indazol-3-yl]carbonyl}-L-phenylalaninamide |
| 1H-Indazole-3-carboxamide, N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-1-(cyclohexylmethyl)- |
| N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(cyclohexylmethyl)indazole-3-carboxamide |