4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride
Modify Date: 2026-08-29 12:07:52
![4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride Structure](https://www.chemsrc.com/extcaspic/317/1185243-54-2.png)
4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride structure
|
Common Name | 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1185243-54-2 | Molecular Weight | 297.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24ClNO2 |
|---|---|
| Molecular Weight | 297.82 |
| InChIKey | GDXZHLKFMSQXJN-BJILWQEISA-N |
| SMILES | Cc1cccc(C)c1OCC=CCN1CCOCC1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1185243-54-2? |
| A: Chinese name of 1185243-54-2 is 1185243-54-2. |
| Q: What is the molecular weight of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: Molecular weight of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is 297.82. |
| Q: What is the InChIKey of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: InChIKey of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is GDXZHLKFMSQXJN-BJILWQEISA-N. |
| Q: What is the molecular formula of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: Molecular formula of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is C16H24ClNO2. |
| Q: What is the CAS number of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: CAS number of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is 1185243-54-2. |
| Q: What is the SMILES notation of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: SMILES notation of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is Cc1cccc(C)c1OCC=CCN1CCOCC1.Cl. |
| Q: What is the English name of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride? |
| A: The English name of 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride is 4-[4-(2,6-Dimethylphenoxy)but-2-en-1-yl]morpholine hydrochloride. |