Thieno[2,3-d]pyridazine-6(7H)-acetic acid,-alpha--methyl-7-oxo- structure
|
Common Name | Thieno[2,3-d]pyridazine-6(7H)-acetic acid,-alpha--methyl-7-oxo- | ||
|---|---|---|---|---|
| CAS Number | 118376-66-2 | Molecular Weight | 224.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(7-Oxothieno[2,3-d]pyridazin-6(7H)-yl)propanoic acid |
|---|
| Molecular Formula | C9H8N2O3S |
|---|---|
| Molecular Weight | 224.23600 |
| Exact Mass | 224.02600 |
| PSA | 100.43000 |
| LogP | 1.10360 |
| InChIKey | KMUWXPCWBASINI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)n1ncc2ccsc2c1=O |
|
~31%
Thieno[2,3-d]py... CAS#:118376-66-2 |
| Literature: New; Christopher; Jass Journal of Organic Chemistry, 1989 , vol. 54, # 4 p. 990 - 992 |
|
~%
Thieno[2,3-d]py... CAS#:118376-66-2 |
| Literature: New; Christopher; Jass Journal of Organic Chemistry, 1989 , vol. 54, # 4 p. 990 - 992 |