4-(4-methylphenyl)sulfonylbut-3-en-2-ol
Modify Date: 2025-09-20 17:25:58
4-(4-methylphenyl)sulfonylbut-3-en-2-ol structure
|
Common Name | 4-(4-methylphenyl)sulfonylbut-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 118356-25-5 | Molecular Weight | 226.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methylphenyl)sulfonylbut-3-en-2-ol |
|---|
| Molecular Formula | C11H14O3S |
|---|---|
| Molecular Weight | 226.29200 |
| Exact Mass | 226.06600 |
| PSA | 62.75000 |
| LogP | 2.74400 |
| InChIKey | RELLNWGXGGPKBF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C=CC(C)O)cc1 |
|
~%
4-(4-methylphen... CAS#:118356-25-5 |
| Literature: Ogura, Katsuyuki; Kayano, Akio; Akazome, Motohiro Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 12 p. 3091 - 3101 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |