3-(benzylamino)-4-Methylpentanoic acid structure
|
Common Name | 3-(benzylamino)-4-Methylpentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 118248-61-6 | Molecular Weight | 221.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (rac)-3-benzylamino-4-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29500 |
| Exact Mass | 221.14200 |
| PSA | 49.33000 |
| LogP | 2.66640 |
| InChIKey | CRGHGHLMEXVSAO-UHFFFAOYSA-N |
| SMILES | CC(C)C(CC(=O)O)NCc1ccccc1 |
|
~87%
3-(benzylamino)... CAS#:118248-61-6 |
| Literature: Dzygiel, Pawel; Monti, Chiara; Piarulli, Umberto; Gennari, Cesare Organic and Biomolecular Chemistry, 2007 , vol. 5, # 21 p. 3464 - 3471 |
|
~%
3-(benzylamino)... CAS#:118248-61-6 |
| Literature: Williams; Lee; Miller; Anderson Journal of the American Chemical Society, 1989 , vol. 111, # 3 p. 1073 - 1081 |
| .N-Bn- |
| .3-benzylamino-4-methylpentanoic acid |