2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate structure
|
Common Name | 2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate | ||
|---|---|---|---|---|
| CAS Number | 118068-28-3 | Molecular Weight | 246.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-butoxy-2-oxoethyl)-2-hydroxybutanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14O7 |
|---|---|
| Molecular Weight | 246.21400 |
| Exact Mass | 246.07400 |
| PSA | 126.79000 |
| InChIKey | TWUZWTIVCCRAAD-UHFFFAOYSA-L |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)[O-])C(=O)[O-] |
|
~%
2-(2-butoxy-2-o... CAS#:118068-28-3
Detail
|
| Literature: Board of Trustees of Michigan State University Patent: EP1849764 A1, 2007 ; Location in patent: Page/Page column 21-22 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2,3-Propanetricarboxylic acid,2-hydroxy-,1-butyl ester |
| 2-Hydroxy-1,2,3-propanetricarboxylic Acid 1-Butyl Ester |
| monobutyl citrate |