ethyl N-[2-[4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenoxy]ethyl]carbamate
Modify Date: 2025-09-10 11:33:47
![ethyl N-[2-[4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenoxy]ethyl]carbamate Structure](https://image.chemsrc.com/caspic/181/118025-42-6.png)
ethyl N-[2-[4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenoxy]ethyl]carbamate structure
|
Common Name | ethyl N-[2-[4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenoxy]ethyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 118025-42-6 | Molecular Weight | 363.44800 | |
| Density | 1.16g/cm3 | Boiling Point | 525.4ºC at 760mmHg | |
| Molecular Formula | C20H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.6ºC | |
| Name | ethyl N-[2-[4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenoxy]ethyl]carbamate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 525.4ºC at 760mmHg |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.44800 |
| Flash Point | 271.6ºC |
| Exact Mass | 363.20500 |
| PSA | 69.51000 |
| LogP | 3.49170 |
| Vapour Pressure | 3.92E-11mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | QFCNUIMNCFEDGF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NCCOc1ccc(CC2CCCCC23OCCO3)cc1 |
|
~%
ethyl N-[2-[4-(... CAS#:118025-42-6 |
| Literature: Wimmer; Saman; Nemec; Francke Helvetica Chimica Acta, 1994 , vol. 77, # 2 p. 561 - 568 |
|
~%
ethyl N-[2-[4-(... CAS#:118025-42-6 |
| Literature: Wimmer; Saman; Nemec; Francke Helvetica Chimica Acta, 1994 , vol. 77, # 2 p. 561 - 568 |
|
~23%
ethyl N-[2-[4-(... CAS#:118025-42-6 |
| Literature: Wimmer, Zdenek; Streinz, Ludvik; Romanuk, Miroslav Collection of Czechoslovak Chemical Communications, 1985 , vol. 50, # 11 p. 2453 - 2456 |
![2-[(4-hydroxyphenyl)methyl]cyclohexan-1-one structure](https://image.chemsrc.com/caspic/125/22081-10-3.png)
![4-(1,4-dioxaspiro[4.5]decan-6-ylmethyl)phenol structure](https://image.chemsrc.com/caspic/314/80826-41-1.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |