Boc-DL-Glu(OBzl)-OH structure
|
Common Name | Boc-DL-Glu(OBzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 117997-81-6 | Molecular Weight | 337.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 522.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.9±30.1 °C | |
| Name | Boc-DL-Glu(OBzl)-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.6±50.0 °C at 760 mmHg |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.368 |
| Flash Point | 269.9±30.1 °C |
| Exact Mass | 337.152527 |
| PSA | 101.93000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | AJDUMMXHVCMISJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | 2-8°C |
|
~99%
Boc-DL-Glu(OBzl)-OH CAS#:117997-81-6 |
| Literature: Pechar, Michal; Strohalm, Jiri; Ulbrich, Karel Collection of Czechoslovak Chemical Communications, 1995 , vol. 60, # 10 p. 1765 - 1780 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid |
| L-N-Boc-3,5-diiodotyrosine |
| N-Boc-3,5-diiodo-L-tyrosine |
| Boc-3',5'-diiodo-L-tyrosine |
| Boc-diiodotyrosine |
| N-Boc-o,o'-diiodo-tyrosine |
| L-BOC-Diiodotyrosine |
| 2-tert-Butoxycarbonylamino-pentanedioic acid 5-benzyl ester |
| Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(phenylmethyl) ester |