1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid
Modify Date: 2025-06-01 09:20:06
1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid structure
|
Common Name | 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 117918-58-8 | Molecular Weight | 225.26400 | |
| Density | 1.421g/cm3 | Boiling Point | 445.3ºC at 760mmHg | |
| Molecular Formula | C10H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | 1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 445.3ºC at 760mmHg |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.26400 |
| Flash Point | 223.1ºC |
| Exact Mass | 225.04600 |
| PSA | 85.85000 |
| LogP | 1.37520 |
| Vapour Pressure | 1.03E-08mmHg at 25°C |
| InChIKey | IILFMWQTZZFXTM-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCCN1C(=O)c1cccs1 |
| HS Code | 2934999090 |
|---|
|
~%
1-(thiophene-2-... CAS#:117918-58-8 |
| Literature: Laduree, Daniel; Lancelot, Jean-Charles; Robba, Max; Chenu, E.; Mathe, G. Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 456 - 461 |
|
~%
1-(thiophene-2-... CAS#:117918-58-8 |
| Literature: Laduree, Daniel; Lancelot, Jean-Charles; Robba, Max; Chenu, E.; Mathe, G. Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 456 - 461 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |