3-(3-chlorophenyl)-2-phenyl-1,3-thiazolidin-4-one structure
|
Common Name | 3-(3-chlorophenyl)-2-phenyl-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 117664-55-8 | Molecular Weight | 289.78000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chlorophenyl)-2-phenyl-1,3-thiazolidin-4-one |
|---|
| Molecular Formula | C15H12ClNOS |
|---|---|
| Molecular Weight | 289.78000 |
| Exact Mass | 289.03300 |
| PSA | 45.61000 |
| LogP | 4.18360 |
| InChIKey | IDKJPPCDJCAPBV-UHFFFAOYSA-N |
| SMILES | O=C1CSC(c2ccccc2)N1c1cccc(Cl)c1 |
|
~54%
3-(3-chlorophen... CAS#:117664-55-8 |
| Literature: Tierney, John Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 997 - 1001 |
|
~%
3-(3-chlorophen... CAS#:117664-55-8 |
| Literature: Tierney, John Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 997 - 1001 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |