dimethyl-phenyl-(thiophen-3-ylmethoxy)silane structure
|
Common Name | dimethyl-phenyl-(thiophen-3-ylmethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 117657-61-1 | Molecular Weight | 248.41600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16OSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl-phenyl-(thiophen-3-ylmethoxy)silane |
|---|
| Molecular Formula | C13H16OSSi |
|---|---|
| Molecular Weight | 248.41600 |
| Exact Mass | 248.06900 |
| PSA | 37.47000 |
| LogP | 3.37700 |
| InChIKey | XTLNDKQHEANWMQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(OCc1ccsc1)c1ccccc1 |
|
~71%
dimethyl-phenyl... CAS#:117657-61-1 |
| Literature: Kennedy-Smith, Joshua J.; Nolin, Kristine A.; Gunterman, Haluna P.; Toste, F.Dean Journal of the American Chemical Society, 2003 , vol. 125, # 14 p. 4056 - 4057 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |