CHEMBRDG-BB 4011734
Modify Date: 2025-08-31 00:13:47
CHEMBRDG-BB 4011734 structure
|
Common Name | CHEMBRDG-BB 4011734 | ||
|---|---|---|---|---|
| CAS Number | 117654-86-1 | Molecular Weight | 279.37500 | |
| Density | 1.063g/cm3 | Boiling Point | 403.3ºC at 760 mmHg | |
| Molecular Formula | C16H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | tert-butyl N-benzyl-N-(4-hydroxybutyl)carbamate |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 403.3ºC at 760 mmHg |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.37500 |
| Flash Point | 197.7ºC |
| Exact Mass | 279.18300 |
| PSA | 49.77000 |
| LogP | 3.19620 |
| Vapour Pressure | 3.15E-07mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | LJWTWHZDQSLGOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCCCO)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |