6,7-dimethoxy-2-(2-(4-methoxyphenyl)ethyl)chromone
Modify Date: 2025-08-25 15:26:02
6,7-dimethoxy-2-(2-(4-methoxyphenyl)ethyl)chromone structure
|
Common Name | 6,7-dimethoxy-2-(2-(4-methoxyphenyl)ethyl)chromone | ||
|---|---|---|---|---|
| CAS Number | 117596-92-6 | Molecular Weight | 340.37 | |
| Density | 1.192g/cm3 | Boiling Point | 511.3ºC at 760mmHg | |
| Molecular Formula | C20H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
Use of 6,7-dimethoxy-2-(2-(4-methoxyphenyl)ethyl)chromoneNF-κB-IN-13 (compound 12) can significantly inhibit LPS-induced NF-κB activation and NO production in RAW264.7 macrophages. NF-κB-IN-13 has anti-inflammatory effects[1]. |
| Name | 6,7-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | NF-κB-IN-13 (compound 12) can significantly inhibit LPS-induced NF-κB activation and NO production in RAW264.7 macrophages. NF-κB-IN-13 has anti-inflammatory effects[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB |
| References |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 511.3ºC at 760mmHg |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.37 |
| Flash Point | 225.1ºC |
| Exact Mass | 340.13100 |
| PSA | 57.90000 |
| LogP | 3.60400 |
| Vapour Pressure | 1.44E-10mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | WYSWREVQEJRZIQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCc2cc(=O)c3cc(OC)c(OC)cc3o2)cc1 |
| dmpec |