Clenproperol-D7
Modify Date: 2025-08-27 22:49:02
Clenproperol-D7 structure
|
Common Name | Clenproperol-D7 | ||
|---|---|---|---|---|
| CAS Number | 1173021-09-4 | Molecular Weight | 270.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9D7Cl2N2O | Melting Point | 109-111°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Clenproperol-D7Clenproperol-D7 is the deuterium labeled Clenproperol. Clenproperol is a β2-adrenergic agonist[1]. |
| Name | Clenproperol |
|---|---|
| Synonym | More Synonyms |
| Description | Clenproperol-D7 is the deuterium labeled Clenproperol. Clenproperol is a β2-adrenergic agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 109-111°C |
|---|---|
| Molecular Formula | C11H9D7Cl2N2O |
| Molecular Weight | 270.20700 |
| Exact Mass | 269.10800 |
| PSA | 58.28000 |
| LogP | 3.57910 |
| InChIKey | JXUDZCJTCKCTQK-NWOXSKRJSA-N |
| SMILES | CC(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 |
| Storage condition | -20?C Freezer |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| 1-(4-Amino-3,5-dichlorophenyl)-2-isopropyl-d7-aminoethanol |
| 1-(4-amino-3,5-dichlorophenyl)-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)ethanol |
| Clenproperol-D7 |