(2S,4R)-1-(Diisopropoxyphosphoryl)-4-hydroxypyrrolidine-2-carboxylic acid
Modify Date: 2025-08-26 00:32:21
(2S,4R)-1-(Diisopropoxyphosphoryl)-4-hydroxypyrrolidine-2-carboxylic acid structure
|
Common Name | (2S,4R)-1-(Diisopropoxyphosphoryl)-4-hydroxypyrrolidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 117286-92-7 | Molecular Weight | 295.26900 | |
| Density | 1.278g/cm3 | Boiling Point | 421.871ºC at 760 mmHg | |
| Molecular Formula | C11H22NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.94ºC | |
| Name | (2S,4R)-1-(Diisopropoxyphosphoryl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 421.871ºC at 760 mmHg |
| Molecular Formula | C11H22NO6P |
| Molecular Weight | 295.26900 |
| Flash Point | 208.94ºC |
| Exact Mass | 295.11800 |
| PSA | 106.11000 |
| LogP | 1.40220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | GDXYIXOXIZJSET-ZJUUUORDSA-N |
| SMILES | CC(C)OP(=O)(OC(C)C)N1CC(O)CC1C(=O)O |
|
~82%
(2S,4R)-1-(Diis... CAS#:117286-92-7 |
| Literature: Brands, Karel M J; Jobson, Ronald B; Conrad, Karen M; Williams, J Michael; Pipik, Brenda; Cameron, Mark; Davies, Antony J; Houghton, Peter G; Ashwood, Michael S; Cottrell, Ian F; Reamer, Robert A; Kennedy, Derek J; Dolling, Ulf-H; Reider, Paul J The Journal of organic chemistry, 2002 , vol. 67, # 14 p. 4771 - 4776 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-di-isopropyloxyphosphoryl-trans-4-hydroxyproline |
| N-(O,O-diisopropylphosphoryl)-trans-4-hydroxy-L-proline |
| N-diisopropyloxyphosphoryl-trans-4-hydroxy-L-proline |
| Diisopropyl(phosphoryl)-trans-4-hydroxyprolin |
| N-(diisopropyl phosphoryl)-trans-4-hydroxy-L-proline |
| N-(O,O-diisopropyl phosphoryl)-trans-4-hydroxy-2-proline |