1-[6-methoxy-6-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone structure
|
Common Name | 1-[6-methoxy-6-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 117211-88-8 | Molecular Weight | 430.44800 | |
| Density | 1.3g/cm3 | Boiling Point | 518ºC at 760mmHg | |
| Molecular Formula | C23H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 1-[6-methoxy-6-methyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 518ºC at 760mmHg |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.44800 |
| Flash Point | 223.4ºC |
| Exact Mass | 430.16300 |
| PSA | 81.68000 |
| LogP | 3.53320 |
| Vapour Pressure | 7.77E-11mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | ZQFDPMHEBRRVRC-UHFFFAOYSA-N |
| SMILES | COc1cc(C2c3cc4c(cc3OC(C)(OC)C2C(C)=O)OCO4)cc(OC)c1OC |
|
~%
1-[6-methoxy-6-... CAS#:117211-88-8 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
|
~%
1-[6-methoxy-6-... CAS#:117211-88-8 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
|
~%
1-[6-methoxy-6-... CAS#:117211-88-8 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |