[4-(Ethylsulfonyl)phenyl]hydrazine hydrochloride (1:1)
Modify Date: 2025-10-15 17:32:12
![[4-(Ethylsulfonyl)phenyl]hydrazine hydrochloride (1:1) Structure](https://image.chemsrc.com/caspic/060/1171829-49-4.png)
[4-(Ethylsulfonyl)phenyl]hydrazine hydrochloride (1:1) structure
|
Common Name | [4-(Ethylsulfonyl)phenyl]hydrazine hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1171829-49-4 | Molecular Weight | 236.71900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(Ethylsulfonyl)phenyl]hydrazine hydrochloride (1:1) |
|---|
| Molecular Formula | C8H13ClN2O2S |
|---|---|
| Molecular Weight | 236.71900 |
| Exact Mass | 236.03900 |
| PSA | 80.57000 |
| LogP | 3.42190 |
| InChIKey | LRKKXMQLFZXKGY-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1ccc(NN)cc1.Cl |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |