Lanperisone
Modify Date: 2025-09-01 18:22:57
Lanperisone structure
|
Common Name | Lanperisone | ||
|---|---|---|---|---|
| CAS Number | 116287-14-0 | Molecular Weight | 285.30500 | |
| Density | 1.17g/cm3 | Boiling Point | 360ºC at 760mmHg | |
| Molecular Formula | C15H18F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
Use of LanperisoneLanperisone (NK 433) is a centrally acting muscle relaxant that selectively kills of K-ras mutant cancer cells in a cell cycle-independent fashion. |
| Name | (2R)-2-methyl-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760mmHg |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.30500 |
| Flash Point | 171.5ºC |
| Exact Mass | 285.13400 |
| PSA | 20.31000 |
| LogP | 3.55790 |
| Vapour Pressure | 2.29E-05mmHg at 25°C |
| Index of Refraction | 1.49 |
| InChIKey | RYZCWZZJFAKYHX-LLVKDONJSA-N |
| SMILES | CC(CN1CCCC1)C(=O)c1ccc(C(F)(F)F)cc1 |
| UNII-TO2JP2G53H |
| Lanperisone |