1-(2-nitrophenyl)ethylidenehydrazine structure
|
Common Name | 1-(2-nitrophenyl)ethylidenehydrazine | ||
|---|---|---|---|---|
| CAS Number | 116271-34-2 | Molecular Weight | 179.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-nitrophenyl)ethylidenehydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9N3O2 |
|---|---|
| Molecular Weight | 179.17600 |
| Exact Mass | 179.06900 |
| PSA | 84.20000 |
| LogP | 2.50100 |
| InChIKey | QJWDISQVXGQOQQ-UHFFFAOYSA-N |
| SMILES | CC(=NN)c1ccccc1[N+](=O)[O-] |
|
~92%
1-(2-nitropheny... CAS#:116271-34-2 |
| Literature: Sainlos, Matthieu; Iskenderian-Epps, Wendy S.; Olivier, Nelson B.; Choquet, Daniel; Imperiali, Barbara Journal of the American Chemical Society, 2013 , vol. 135, # 12 p. 4580 - 4583 |
| 2'-nitroacetophenone hydrazone |
| hydrazone of 2-nitroacetophenone |