2-(2-amino-6-bromo-3-methoxyphenyl)acetohydrazide
Modify Date: 2025-11-18 19:11:48
2-(2-amino-6-bromo-3-methoxyphenyl)acetohydrazide structure
|
Common Name | 2-(2-amino-6-bromo-3-methoxyphenyl)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 1162262-32-9 | Molecular Weight | 274.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-amino-6-bromo-3-methoxyphenyl)acetohydrazide |
|---|
| Molecular Formula | C9H12BrN3O2 |
|---|---|
| Molecular Weight | 274.11400 |
| Exact Mass | 273.01100 |
| PSA | 93.86000 |
| LogP | 2.69410 |
| InChIKey | NTEYUWDXTNQTRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c(CC(=O)NN)c1N |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |