2-hydroxy-3-(4-nitrophenyl)prop-2-enal
Modify Date: 2025-10-04 10:40:05
2-hydroxy-3-(4-nitrophenyl)prop-2-enal structure
|
Common Name | 2-hydroxy-3-(4-nitrophenyl)prop-2-enal | ||
|---|---|---|---|---|
| CAS Number | 116204-36-5 | Molecular Weight | 193.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-3-(4-nitrophenyl)prop-2-enal |
|---|
| Molecular Formula | C9H7NO4 |
|---|---|
| Molecular Weight | 193.15600 |
| Exact Mass | 193.03800 |
| PSA | 83.12000 |
| LogP | 2.21580 |
| InChIKey | VKDMHVGBEQABHB-UHFFFAOYSA-N |
| SMILES | O=CC(O)=Cc1ccc([N+](=O)[O-])cc1 |
|
~%
2-hydroxy-3-(4-... CAS#:116204-36-5 |
| Literature: Khamliche, Layachi; Robert, Albert Journal of the Chemical Society, Chemical Communications, 1987 , p. 1869 - 1870 |
