4,7-diphenyl-2-benzofuran-1,3-dione structure
|
Common Name | 4,7-diphenyl-2-benzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1162-64-7 | Molecular Weight | 300.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,7-diphenyl-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H12O3 |
|---|---|
| Molecular Weight | 300.30700 |
| Exact Mass | 300.07900 |
| PSA | 43.37000 |
| LogP | 4.33120 |
| InChIKey | SLWAADXFJSKGOJ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2c(-c3ccccc3)ccc(-c3ccccc3)c21 |
| HS Code | 2932999099 |
|---|
|
~%
4,7-diphenyl-2-... CAS#:1162-64-7 |
| Literature: Journal of Organic Chemistry, , vol. 72, # 8 p. 3020 - 3030 |
|
~12%
4,7-diphenyl-2-... CAS#:1162-64-7 |
| Literature: Chemistry - A European Journal, , vol. 16, # 46 p. 13646 - 13658 |
|
~%
4,7-diphenyl-2-... CAS#:1162-64-7 |
| Literature: US2264429 , ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6-Diphenyl-phthalsaeureanhydrid |
| 4,7-Diphenylisobenzofuran-1,3-dione |
| p-terphenyl-2',3'-dicarboxylic acid anhydride |
| 4,7-diphenylphthalic anhydride |
| 3,6-diphenyl-phthalic acid-anhydride |
| 3,6-diphenylphthalic anhydride |
| 1,3-Isobenzofurandione,4,7-diphenyl |