Re 80
Modify Date: 2025-08-25 16:44:11
Re 80 structure
|
Common Name | Re 80 | ||
|---|---|---|---|---|
| CAS Number | 116193-60-3 | Molecular Weight | 394.46000 | |
| Density | 1.212g/cm3 | Boiling Point | 613.6ºC at 760mmHg | |
| Molecular Formula | C24H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.9ºC | |
Use of Re 80Re 80 is an anti-angiogenic agent and is a synthetic retinoid[1]. |
| Name | 4-[(Z)-1-hydroxy-3-(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Re 80 is an anti-angiogenic agent and is a synthetic retinoid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 613.6ºC at 760mmHg |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.46000 |
| Flash Point | 338.9ºC |
| Exact Mass | 394.17800 |
| PSA | 94.83000 |
| LogP | 5.22120 |
| Vapour Pressure | 6.54E-16mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | PZYFNWUXYUMHGR-UYRXBGFRSA-N |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)C=C(O)c3ccc(C(=O)O)cc3)c(O)cc21 |
| Re 80 |