pn 203-831
Modify Date: 2025-08-25 21:28:33
pn 203-831 structure
|
Common Name | pn 203-831 | ||
|---|---|---|---|---|
| CAS Number | 116169-18-7 | Molecular Weight | 369.37100 | |
| Density | 1.261g/cm3 | Boiling Point | 471.64ºC at 760 mmHg | |
| Molecular Formula | C19H19N3O5 | Melting Point | 53-55?C | |
| MSDS | N/A | Flash Point | 239.04ºC | |
| Name | 5-O-methyl 3-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 471.64ºC at 760 mmHg |
| Melting Point | 53-55?C |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.37100 |
| Flash Point | 239.04ºC |
| Exact Mass | 369.13200 |
| PSA | 104.41000 |
| LogP | 3.25340 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XXUCEEUFISNYCI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OC(C)C)c1-c1cccc2nonc12 |
| Storage condition | Refrigerator |
| RIDADR | NONH for all modes of transport |
|---|
| Isradipine impurity D |
| Dehydro Isradipine |
| PN 203-831 |