propan-2-yl 3,9-dimethyldeca-2,4-dienoate structure
|
Common Name | propan-2-yl 3,9-dimethyldeca-2,4-dienoate | ||
|---|---|---|---|---|
| CAS Number | 116161-58-1 | Molecular Weight | 238.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propan-2-yl 3,9-dimethyldeca-2,4-dienoate |
|---|
| Molecular Formula | C15H26O2 |
|---|---|
| Molecular Weight | 238.36600 |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 4.26680 |
| InChIKey | YMUCPSIYWYUNCM-UHFFFAOYSA-N |
| SMILES | CC(C=CCCCC(C)C)=CC(=O)OC(C)C |
|
~68%
propan-2-yl 3,9... CAS#:116161-58-1 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , vol. 36, # 11 p. 2447 - 2448 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , # 11 p. 2633 - 2634 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |