(E)-1,3-bis[4-(dimethylamino)phenyl]prop-2-en-1-one structure
|
Common Name | (E)-1,3-bis[4-(dimethylamino)phenyl]prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 1161-22-4 | Molecular Weight | 294.39100 | |
| Density | 1.107g/cm3 | Boiling Point | 475.1ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | (E)-1,3-bis[4-(dimethylamino)phenyl]prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 475.1ºC at 760 mmHg |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.39100 |
| Flash Point | 206.4ºC |
| Exact Mass | 294.17300 |
| PSA | 23.55000 |
| LogP | 3.71470 |
| Vapour Pressure | 3.43E-09mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | YFMNMPLJIWVXER-VGOFMYFVSA-N |
| SMILES | CN(C)c1ccc(C=CC(=O)c2ccc(N(C)C)cc2)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4.4'-Bis-dimethylamino-chalkon |